C29H30Cl2FN3O5S — CID 163663890
4-[[(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-[(5-chlorothiophen-3-yl)carbamoyl]-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoic acid (PubChem CID 163663890) has the molecular formula C29H30Cl2FN3O5S and a molecular weight of 622.55 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-[(5-chlorothiophen-3-yl)carbamoyl]-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoic acid.
| Compound Name | 4-[[(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-[(5-chlorothiophen-3-yl)carbamoyl]-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 163663890 |
| Molecular Formula | C29H30Cl2FN3O5S |
| Molecular Weight | 622.55 g/mol |
| Exact Mass | 621.13 |
| IUPAC Name | 4-[[(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-[(5-chlorothiophen-3-yl)carbamoyl]-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@@H](C(=O)Nc2csc(Cl)c2)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C29H30Cl2FN3O5S/c1-29(2,3)12-19-23(26(36)33-15-11-21(31)41-13-15)22(16-6-5-7-17(30)24(16)32)25(34-19)27(37)35-18-9-8-14(28(38)39)10-20(18)40-4/h5-11,13,19,22-23,25,34H,12H2,1-4H3,(H,33,36)(H,35,37)(H,38,39)/t19-,22+,23+,25+/m0/s1 |
| InChIKey | IWSDALIHKNKNLD-JWMZNBFRSA-N |
| XLogP | 6.65 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |