C8H11N3O3 — CID 163664662
5-[methyl(prop-1-en-2-yl)amino]-1,3-diazinane-2,4,6-trione (PubChem CID 163664662) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 5-[methyl(prop-1-en-2-yl)amino]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[methyl(prop-1-en-2-yl)amino]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 163664662 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 5-[methyl(prop-1-en-2-yl)amino]-1,3-diazinane-2,4,6-trione |
| SMILES | C=C(C)N(C)C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C8H11N3O3/c1-4(2)11(3)5-6(12)9-8(14)10-7(5)13/h5H,1H2,2-3H3,(H2,9,10,12,13,14) |
| InChIKey | IXJBIOZPQSRAJX-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|