C18H23N — CID 163665843
N-(3,5-dimethylphenyl)-2,3,4,5-tetramethylaniline (PubChem CID 163665843) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2,3,4,5-tetramethylaniline.
| Compound Name | N-(3,5-dimethylphenyl)-2,3,4,5-tetramethylaniline |
|---|---|
| PubChem CID | 163665843 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2,3,4,5-tetramethylaniline |
| SMILES | Cc1cc(C)cc(Nc2cc(C)c(C)c(C)c2C)c1 |
| InChI | InChI=1S/C18H23N/c1-11-7-12(2)9-17(8-11)19-18-10-13(3)14(4)15(5)16(18)6/h7-10,19H,1-6H3 |
| InChIKey | IYJPHLGALQDDPJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |