C21H29N3 — CID 163666400
N'-[[4-[(dimethylamino)methyl]-9H-fluoren-2-yl]methyl]-N,N,N'-trimethylmethanediamine (PubChem CID 163666400) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is N'-[[4-[(dimethylamino)methyl]-9H-fluoren-2-yl]methyl]-N,N,N'-trimethylmethanediamine.
| Compound Name | N'-[[4-[(dimethylamino)methyl]-9H-fluoren-2-yl]methyl]-N,N,N'-trimethylmethanediamine |
|---|---|
| PubChem CID | 163666400 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | N'-[[4-[(dimethylamino)methyl]-9H-fluoren-2-yl]methyl]-N,N,N'-trimethylmethanediamine |
| SMILES | CN(C)Cc1cc(CN(C)CN(C)C)cc2c1-c1ccccc1C2 |
| InChI | InChI=1S/C21H29N3/c1-22(2)14-19-11-16(13-24(5)15-23(3)4)10-18-12-17-8-6-7-9-20(17)21(18)19/h6-11H,12-15H2,1-5H3 |
| InChIKey | UPJVWRODBCPBIT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|