C14H13F4NO2 — CID 163668189
ethyl N-[2-fluoro-6-(2-methylcyclopropen-1-yl)-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 163668189) has the molecular formula C14H13F4NO2 and a molecular weight of 303.26 g/mol. Its IUPAC name is ethyl N-[2-fluoro-6-(2-methylcyclopropen-1-yl)-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | ethyl N-[2-fluoro-6-(2-methylcyclopropen-1-yl)-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 163668189 |
| Molecular Formula | C14H13F4NO2 |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | ethyl N-[2-fluoro-6-(2-methylcyclopropen-1-yl)-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1c(F)cc(C(F)(F)F)cc1C1=C(C)C1 |
| InChI | InChI=1S/C14H13F4NO2/c1-3-21-13(20)19-12-10(9-4-7(9)2)5-8(6-11(12)15)14(16,17)18/h5-6H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | JAGIYUFXXXIQPQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |