C10H11N2O2- — CID 163670046
6-methyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylate (PubChem CID 163670046) has the molecular formula C10H11N2O2- and a molecular weight of 191.21 g/mol. Its IUPAC name is 6-methyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylate.
| Compound Name | 6-methyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 163670046 |
| Molecular Formula | C10H11N2O2- |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 6-methyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxylate |
| SMILES | CN1CCc2nc(C(=O)[O-])ccc2C1 |
| InChI | InChI=1S/C10H12N2O2/c1-12-5-4-8-7(6-12)2-3-9(11-8)10(13)14/h2-3H,4-6H2,1H3,(H,13,14)/p-1 |
| InChIKey | JBSZGTIEYFCKQQ-UHFFFAOYSA-M |
| XLogP | -0.57 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |