C24H30IN3O6 — CID 163672335
benzyl (2R)-2-amino-2-[[(2S)-2-(3-iodo-4-methoxyphenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]acetate (PubChem CID 163672335) has the molecular formula C24H30IN3O6 and a molecular weight of 583.42 g/mol. Its IUPAC name is benzyl (2R)-2-amino-2-[[(2S)-2-(3-iodo-4-methoxyphenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]acetate.
| Compound Name | benzyl (2R)-2-amino-2-[[(2S)-2-(3-iodo-4-methoxyphenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 163672335 |
| Molecular Formula | C24H30IN3O6 |
| Molecular Weight | 583.42 g/mol |
| Exact Mass | 583.12 |
| IUPAC Name | benzyl (2R)-2-amino-2-[[(2S)-2-(3-iodo-4-methoxyphenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]acetate |
| SMILES | COc1ccc([C@@H](C(=O)N[C@@H](N)C(=O)OCc2ccccc2)N(C)C(=O)OC(C)(C)C)cc1I |
| InChI | InChI=1S/C24H30IN3O6/c1-24(2,3)34-23(31)28(4)19(16-11-12-18(32-5)17(25)13-16)21(29)27-20(26)22(30)33-14-15-9-7-6-8-10-15/h6-13,19-20H,14,26H2,1-5H3,(H,27,29)/t19-,20+/m0/s1 |
| InChIKey | JDQOQCSGUCQUFT-VQTJNVASSA-N |
| XLogP | 3.35 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|