C26H35N3O6 — CID 126712426
benzyl (2S,3R)-2-[[(2R)-2-amino-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]-3-phenylmethoxybutanoate (PubChem CID 126712426) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is benzyl (2S,3R)-2-[[(2R)-2-amino-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]-3-phenylmethoxybutanoate.
| Compound Name | benzyl (2S,3R)-2-[[(2R)-2-amino-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]-3-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 126712426 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | benzyl (2S,3R)-2-[[(2R)-2-amino-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]-3-phenylmethoxybutanoate |
| SMILES | C[C@@H](OCc1ccccc1)[C@H](NC(=O)[C@H](N)N(C)C(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H35N3O6/c1-18(33-16-19-12-8-6-9-13-19)21(24(31)34-17-20-14-10-7-11-15-20)28-23(30)22(27)29(5)25(32)35-26(2,3)4/h6-15,18,21-22H,16-17,27H2,1-5H3,(H,28,30)/t18-,21+,22-/m1/s1 |
| InChIKey | QOFQEZYODMTRHA-BVYCBKJFSA-N |
| XLogP | 2.97 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|