C29H37IN2O8 — CID 159944938
methyl (2R,5S)-5-[3-iodo-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-2-methyl-5-[methyl(phenylmethoxycarbonyl)amino]-4-oxopentanoate (PubChem CID 159944938) has the molecular formula C29H37IN2O8 and a molecular weight of 668.53 g/mol. Its IUPAC name is methyl (2R,5S)-5-[3-iodo-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-2-methyl-5-[methyl(phenylmethoxycarbonyl)amino]-4-oxopentanoate.
| Compound Name | methyl (2R,5S)-5-[3-iodo-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-2-methyl-5-[methyl(phenylmethoxycarbonyl)amino]-4-oxopentanoate |
|---|---|
| PubChem CID | 159944938 |
| Molecular Formula | C29H37IN2O8 |
| Molecular Weight | 668.53 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | methyl (2R,5S)-5-[3-iodo-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-2-methyl-5-[methyl(phenylmethoxycarbonyl)amino]-4-oxopentanoate |
| SMILES | COC(=O)[C@H](C)CC(=O)[C@H](c1ccc(OCCNC(=O)OC(C)(C)C)c(I)c1)N(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H37IN2O8/c1-19(26(34)37-6)16-23(33)25(32(5)28(36)39-18-20-10-8-7-9-11-20)21-12-13-24(22(30)17-21)38-15-14-31-27(35)40-29(2,3)4/h7-13,17,19,25H,14-16,18H2,1-6H3,(H,31,35)/t19-,25+/m1/s1 |
| InChIKey | QFWDKZUXRQDIBV-CLOONOSVSA-N |
| XLogP | 5.27 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|