C10H13NO — CID 163674685
7-methyl-1,2,4a,8a-tetrahydroquinolin-8-ol (PubChem CID 163674685) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 7-methyl-1,2,4a,8a-tetrahydroquinolin-8-ol.
| Compound Name | 7-methyl-1,2,4a,8a-tetrahydroquinolin-8-ol |
|---|---|
| PubChem CID | 163674685 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 7-methyl-1,2,4a,8a-tetrahydroquinolin-8-ol |
| SMILES | CC1=C(O)C2NCC=CC2C=C1 |
| InChI | InChI=1S/C10H13NO/c1-7-4-5-8-3-2-6-11-9(8)10(7)12/h2-5,8-9,11-12H,6H2,1H3 |
| InChIKey | JFQHEYASPKVQRV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|