C11H16O5S2 — CID 163674992
5-butan-2-yl-2-methoxybenzene-1,3-disulfinic acid (PubChem CID 163674992) has the molecular formula C11H16O5S2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-butan-2-yl-2-methoxybenzene-1,3-disulfinic acid.
| Compound Name | 5-butan-2-yl-2-methoxybenzene-1,3-disulfinic acid |
|---|---|
| PubChem CID | 163674992 |
| Molecular Formula | C11H16O5S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 5-butan-2-yl-2-methoxybenzene-1,3-disulfinic acid |
| SMILES | CCC(C)c1cc(S(=O)O)c(OC)c(S(=O)O)c1 |
| InChI | InChI=1S/C11H16O5S2/c1-4-7(2)8-5-9(17(12)13)11(16-3)10(6-8)18(14)15/h5-7H,4H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | JFWLLORSLXWESL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|