C12H18O3 — CID 163966789
5-[(2S)-butan-2-yl]-2,3-dimethoxyphenol (PubChem CID 163966789) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 5-[(2S)-butan-2-yl]-2,3-dimethoxyphenol.
| Compound Name | 5-[(2S)-butan-2-yl]-2,3-dimethoxyphenol |
|---|---|
| PubChem CID | 163966789 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 5-[(2S)-butan-2-yl]-2,3-dimethoxyphenol |
| SMILES | CC[C@H](C)c1cc(O)c(OC)c(OC)c1 |
| InChI | InChI=1S/C12H18O3/c1-5-8(2)9-6-10(13)12(15-4)11(7-9)14-3/h6-8,13H,5H2,1-4H3/t8-/m0/s1 |
| InChIKey | SMMJDPLQZSAFII-QMMMGPOBSA-N |
| XLogP | 2.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |