C10H17N — CID 163677109
(8R)-4,7,8-trimethyl-4-azaspiro[2.5]oct-5-ene (PubChem CID 163677109) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (8R)-4,7,8-trimethyl-4-azaspiro[2.5]oct-5-ene.
| Compound Name | (8R)-4,7,8-trimethyl-4-azaspiro[2.5]oct-5-ene |
|---|---|
| PubChem CID | 163677109 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (8R)-4,7,8-trimethyl-4-azaspiro[2.5]oct-5-ene |
| SMILES | CC1C=CN(C)C2(CC2)[C@@H]1C |
| InChI | InChI=1S/C10H17N/c1-8-4-7-11(3)10(5-6-10)9(8)2/h4,7-9H,5-6H2,1-3H3/t8?,9-/m1/s1 |
| InChIKey | JHPONLGXJOUDBR-YGPZHTELSA-N |
| XLogP | 2.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |