C9H15N — CID 130224141
(8S)-6,8-dimethyl-6-azaspiro[2.5]oct-4-ene (PubChem CID 130224141) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (8S)-6,8-dimethyl-6-azaspiro[2.5]oct-4-ene.
| Compound Name | (8S)-6,8-dimethyl-6-azaspiro[2.5]oct-4-ene |
|---|---|
| PubChem CID | 130224141 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (8S)-6,8-dimethyl-6-azaspiro[2.5]oct-4-ene |
| SMILES | C[C@@H]1CN(C)C=CC12CC2 |
| InChI | InChI=1S/C9H15N/c1-8-7-10(2)6-5-9(8)3-4-9/h5-6,8H,3-4,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | ULCHVSYUHSPFOX-MRVPVSSYSA-N |
| XLogP | 1.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |