C14H27N — CID 59918146
1,4-ditert-butyl-4-methyl-2,3-dihydropyridine (PubChem CID 59918146) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 1,4-ditert-butyl-4-methyl-2,3-dihydropyridine.
| Compound Name | 1,4-ditert-butyl-4-methyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 59918146 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 1,4-ditert-butyl-4-methyl-2,3-dihydropyridine |
| SMILES | CC(C)(C)N1C=CC(C)(C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H27N/c1-12(2,3)14(7)8-10-15(11-9-14)13(4,5)6/h8,10H,9,11H2,1-7H3 |
| InChIKey | RHTYVUGKXHIBBL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |