C38H34O4 — CID 163680281
4-[4-[4-[4-[4-[4-(4-hydroxyphenyl)cyclopenta-1,3-dien-1-yl]phenoxy]butoxy]phenyl]cyclopenta-1,3-dien-1-yl]phenol (PubChem CID 163680281) has the molecular formula C38H34O4 and a molecular weight of 554.69 g/mol. Its IUPAC name is 4-[4-[4-[4-[4-[4-(4-hydroxyphenyl)cyclopenta-1,3-dien-1-yl]phenoxy]butoxy]phenyl]cyclopenta-1,3-dien-1-yl]phenol.
| Compound Name | 4-[4-[4-[4-[4-[4-(4-hydroxyphenyl)cyclopenta-1,3-dien-1-yl]phenoxy]butoxy]phenyl]cyclopenta-1,3-dien-1-yl]phenol |
|---|---|
| PubChem CID | 163680281 |
| Molecular Formula | C38H34O4 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 4-[4-[4-[4-[4-[4-(4-hydroxyphenyl)cyclopenta-1,3-dien-1-yl]phenoxy]butoxy]phenyl]cyclopenta-1,3-dien-1-yl]phenol |
| SMILES | Oc1ccc(C2=CC=C(c3ccc(OCCCCOc4ccc(C5=CC=C(c6ccc(O)cc6)C5)cc4)cc3)C2)cc1 |
| InChI | InChI=1S/C38H34O4/c39-35-15-7-27(8-16-35)31-3-5-33(25-31)29-11-19-37(20-12-29)41-23-1-2-24-42-38-21-13-30(14-22-38)34-6-4-32(26-34)28-9-17-36(40)18-10-28/h3-22,39-40H,1-2,23-26H2 |
| InChIKey | JKGBUPQMKNUSNM-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|