C23H44 — CID 163686361
2-(2-butylheptyl)-5-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 163686361) has the molecular formula C23H44 and a molecular weight of 320.61 g/mol. Its IUPAC name is 2-(2-butylheptyl)-5-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 2-(2-butylheptyl)-5-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 163686361 |
| Molecular Formula | C23H44 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 320.34 |
| IUPAC Name | 2-(2-butylheptyl)-5-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CCCCCC(CCCC)CC1CC2CCC(CCC)CC2C1 |
| InChI | InChI=1S/C23H44/c1-4-7-9-12-20(11-8-5-2)15-21-17-22-14-13-19(10-6-3)16-23(22)18-21/h19-23H,4-18H2,1-3H3 |
| InChIKey | JPFHJYNZBWIGCX-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|