C11H9ClFN4O5S- — CID 163688632
[5-[(3-chloro-2-fluorophenyl)sulfonylamino]-6-methoxypyrazin-2-yl]-dioxidoazanium (PubChem CID 163688632) has the molecular formula C11H9ClFN4O5S- and a molecular weight of 363.73 g/mol. Its IUPAC name is [5-[(3-chloro-2-fluorophenyl)sulfonylamino]-6-methoxypyrazin-2-yl]-dioxidoazanium.
| Compound Name | [5-[(3-chloro-2-fluorophenyl)sulfonylamino]-6-methoxypyrazin-2-yl]-dioxidoazanium |
|---|---|
| PubChem CID | 163688632 |
| Molecular Formula | C11H9ClFN4O5S- |
| Molecular Weight | 363.73 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | [5-[(3-chloro-2-fluorophenyl)sulfonylamino]-6-methoxypyrazin-2-yl]-dioxidoazanium |
| SMILES | COc1nc([NH+]([O-])[O-])cnc1NS(=O)(=O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C11H9ClFN4O5S/c1-22-11-10(14-5-8(15-11)17(18)19)16-23(20,21)7-4-2-3-6(12)9(7)13/h2-5,17H,1H3,(H,14,16)/q-1 |
| InChIKey | JRBSKOITPMZPDX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.73 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|