C12H23N5O — CID 163691487
3,3,4,5,5-pentaamino-1-(4-methylcyclohex-3-en-1-yl)pent-4-en-1-one (PubChem CID 163691487) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is 3,3,4,5,5-pentaamino-1-(4-methylcyclohex-3-en-1-yl)pent-4-en-1-one.
| Compound Name | 3,3,4,5,5-pentaamino-1-(4-methylcyclohex-3-en-1-yl)pent-4-en-1-one |
|---|---|
| PubChem CID | 163691487 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 3,3,4,5,5-pentaamino-1-(4-methylcyclohex-3-en-1-yl)pent-4-en-1-one |
| SMILES | CC1=CCC(C(=O)CC(N)(N)C(N)=C(N)N)CC1 |
| InChI | InChI=1S/C12H23N5O/c1-7-2-4-8(5-3-7)9(18)6-12(16,17)10(13)11(14)15/h2,8H,3-6,13-17H2,1H3 |
| InChIKey | JTIFOQWEQFDKJK-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 147.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|