C11H20BrN — CID 163693507
1-[(1S,2S)-1-(bromomethyl)-2-methylcyclohexyl]-N-ethylmethanimine (PubChem CID 163693507) has the molecular formula C11H20BrN and a molecular weight of 246.19 g/mol. Its IUPAC name is 1-[(1S,2S)-1-(bromomethyl)-2-methylcyclohexyl]-N-ethylmethanimine.
| Compound Name | 1-[(1S,2S)-1-(bromomethyl)-2-methylcyclohexyl]-N-ethylmethanimine |
|---|---|
| PubChem CID | 163693507 |
| Molecular Formula | C11H20BrN |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-[(1S,2S)-1-(bromomethyl)-2-methylcyclohexyl]-N-ethylmethanimine |
| SMILES | CC/N=C/[C@]1(CBr)CCCC[C@@H]1C |
| InChI | InChI=1S/C11H20BrN/c1-3-13-9-11(8-12)7-5-4-6-10(11)2/h9-10H,3-8H2,1-2H3/b13-9+/t10-,11+/m0/s1 |
| InChIKey | JUZILKALUQESCW-XEFHMLBGSA-N |
| XLogP | 3.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|