C19H22O2S — CID 163695405
(1R,4R,7S,10S)-10-hydroxy-9-phenylsulfanyltetracyclo[5.3.3.04,9.04,12]tridecan-8-one (PubChem CID 163695405) has the molecular formula C19H22O2S and a molecular weight of 314.45 g/mol. Its IUPAC name is (1R,4R,7S,10S)-10-hydroxy-9-phenylsulfanyltetracyclo[5.3.3.04,9.04,12]tridecan-8-one.
| Compound Name | (1R,4R,7S,10S)-10-hydroxy-9-phenylsulfanyltetracyclo[5.3.3.04,9.04,12]tridecan-8-one |
|---|---|
| PubChem CID | 163695405 |
| Molecular Formula | C19H22O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (1R,4R,7S,10S)-10-hydroxy-9-phenylsulfanyltetracyclo[5.3.3.04,9.04,12]tridecan-8-one |
| SMILES | O=C1[C@H]2CC[C@]34CC[C@H](CC3C2)[C@H](O)C14Sc1ccccc1 |
| InChI | InChI=1S/C19H22O2S/c20-16-12-6-8-18-9-7-13(11-14(18)10-12)17(21)19(16,18)22-15-4-2-1-3-5-15/h1-5,12-14,16,20H,6-11H2/t12-,13+,14?,16+,18-,19?/m1/s1 |
| InChIKey | JWNOIZIWDQMDGZ-PHSMPBCESA-N |
| XLogP | 3.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |