C26H36O3S — CID 58859313
(1S,4S,5R,9S,10S,12R,13S,14R)-14-hydroxy-5,9-dimethyl-13-(phenylsulfanylmethyl)tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylic acid (PubChem CID 58859313) has the molecular formula C26H36O3S and a molecular weight of 428.64 g/mol. Its IUPAC name is (1S,4S,5R,9S,10S,12R,13S,14R)-14-hydroxy-5,9-dimethyl-13-(phenylsulfanylmethyl)tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylic acid.
| Compound Name | (1S,4S,5R,9S,10S,12R,13S,14R)-14-hydroxy-5,9-dimethyl-13-(phenylsulfanylmethyl)tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 58859313 |
| Molecular Formula | C26H36O3S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (1S,4S,5R,9S,10S,12R,13S,14R)-14-hydroxy-5,9-dimethyl-13-(phenylsulfanylmethyl)tetracyclo[10.2.2.01,10.04,9]hexadecane-5-carboxylic acid |
| SMILES | C[C@@]12CCC[C@@](C)(C(=O)O)[C@H]1CC[C@@]13CC[C@H](C[C@@H]21)[C@H](CSc1ccccc1)[C@H]3O |
| InChI | InChI=1S/C26H36O3S/c1-24-11-6-12-25(2,23(28)29)20(24)10-14-26-13-9-17(15-21(24)26)19(22(26)27)16-30-18-7-4-3-5-8-18/h3-5,7-8,17,19-22,27H,6,9-16H2,1-2H3,(H,28,29)/t17-,19+,20+,21+,22-,24-,25-,26+/m1/s1 |
| InChIKey | MMTKRZFCKGIJQQ-SJTQCXMFSA-N |
| XLogP | 5.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |