C16H18N6 — CID 163697914
N-[1-[1-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]triazol-4-yl]ethyl]methanimine (PubChem CID 163697914) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is N-[1-[1-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]triazol-4-yl]ethyl]methanimine.
| Compound Name | N-[1-[1-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]triazol-4-yl]ethyl]methanimine |
|---|---|
| PubChem CID | 163697914 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[1-[1-[(6-cyclopropylimidazo[1,2-a]pyridin-2-yl)methyl]triazol-4-yl]ethyl]methanimine |
| SMILES | C=NC(C)c1cn(Cc2cn3cc(C4CC4)ccc3n2)nn1 |
| InChI | InChI=1S/C16H18N6/c1-11(17-2)15-10-22(20-19-15)9-14-8-21-7-13(12-3-4-12)5-6-16(21)18-14/h5-8,10-12H,2-4,9H2,1H3 |
| InChIKey | JYMHSGZNAOOMGK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|