C13H27N3 — CID 163698402
(E,2R)-3-(1-hydrazinyl-3-methylbut-3-enyl)oct-6-en-2-amine (PubChem CID 163698402) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is (E,2R)-3-(1-hydrazinyl-3-methylbut-3-enyl)oct-6-en-2-amine.
| Compound Name | (E,2R)-3-(1-hydrazinyl-3-methylbut-3-enyl)oct-6-en-2-amine |
|---|---|
| PubChem CID | 163698402 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | (E,2R)-3-(1-hydrazinyl-3-methylbut-3-enyl)oct-6-en-2-amine |
| SMILES | C=C(C)CC(NN)C(CC/C=C/C)[C@@H](C)N |
| InChI | InChI=1S/C13H27N3/c1-5-6-7-8-12(11(4)14)13(16-15)9-10(2)3/h5-6,11-13,16H,2,7-9,14-15H2,1,3-4H3/b6-5+/t11-,12?,13?/m1/s1 |
| InChIKey | JYWBFBXSZPWTRL-RNOXMHCWSA-N |
| XLogP | 2.10 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|