C25H18Cl2N2O3 — CID 163699685
N-[4-[(4-benzyl-3-oxo-2H-pyridin-6-yl)oxy]-3,5-dichlorophenyl]benzamide (PubChem CID 163699685) has the molecular formula C25H18Cl2N2O3 and a molecular weight of 465.34 g/mol. Its IUPAC name is N-[4-[(4-benzyl-3-oxo-2H-pyridin-6-yl)oxy]-3,5-dichlorophenyl]benzamide.
| Compound Name | N-[4-[(4-benzyl-3-oxo-2H-pyridin-6-yl)oxy]-3,5-dichlorophenyl]benzamide |
|---|---|
| PubChem CID | 163699685 |
| Molecular Formula | C25H18Cl2N2O3 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | N-[4-[(4-benzyl-3-oxo-2H-pyridin-6-yl)oxy]-3,5-dichlorophenyl]benzamide |
| SMILES | O=C1CN=C(Oc2c(Cl)cc(NC(=O)c3ccccc3)cc2Cl)C=C1Cc1ccccc1 |
| InChI | InChI=1S/C25H18Cl2N2O3/c26-20-13-19(29-25(31)17-9-5-2-6-10-17)14-21(27)24(20)32-23-12-18(22(30)15-28-23)11-16-7-3-1-4-8-16/h1-10,12-14H,11,15H2,(H,29,31) |
| InChIKey | VRLCTBCSSDNXMK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |