C10H11F3O — CID 163702022
2-[(E)-2-methoxyethenyl]-3-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 163702022) has the molecular formula C10H11F3O and a molecular weight of 204.19 g/mol. Its IUPAC name is 2-[(E)-2-methoxyethenyl]-3-(trifluoromethyl)cyclohexa-1,3-diene.
| Compound Name | 2-[(E)-2-methoxyethenyl]-3-(trifluoromethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163702022 |
| Molecular Formula | C10H11F3O |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2-[(E)-2-methoxyethenyl]-3-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | CO/C=C/C1=CCCC=C1C(F)(F)F |
| InChI | InChI=1S/C10H11F3O/c1-14-7-6-8-4-2-3-5-9(8)10(11,12)13/h4-7H,2-3H2,1H3/b7-6+ |
| InChIKey | KBVPPLNFNXDVAG-VOTSOKGWSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|