C8H4F6O — CID 134915403
3,6-bis(trifluoromethyl)oxepine (PubChem CID 134915403) has the molecular formula C8H4F6O and a molecular weight of 230.11 g/mol. Its IUPAC name is 3,6-bis(trifluoromethyl)oxepine.
| Compound Name | 3,6-bis(trifluoromethyl)oxepine |
|---|---|
| PubChem CID | 134915403 |
| Molecular Formula | C8H4F6O |
| Molecular Weight | 230.11 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 3,6-bis(trifluoromethyl)oxepine |
| SMILES | FC(F)(F)C1=COC=C(C(F)(F)F)C=C1 |
| InChI | InChI=1S/C8H4F6O/c9-7(10,11)5-1-2-6(4-15-3-5)8(12,13)14/h1-4H |
| InChIKey | DKIWGMUPMFWURW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.11 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |