C10H8F6O — CID 10106545
5-[(E)-2-(2,2,2-trifluoroethoxy)ethenyl]-5-(trifluoromethyl)cyclopenta-1,3-diene (PubChem CID 10106545) has the molecular formula C10H8F6O and a molecular weight of 258.16 g/mol. Its IUPAC name is 5-[(E)-2-(2,2,2-trifluoroethoxy)ethenyl]-5-(trifluoromethyl)cyclopenta-1,3-diene.
| Compound Name | 5-[(E)-2-(2,2,2-trifluoroethoxy)ethenyl]-5-(trifluoromethyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 10106545 |
| Molecular Formula | C10H8F6O |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 5-[(E)-2-(2,2,2-trifluoroethoxy)ethenyl]-5-(trifluoromethyl)cyclopenta-1,3-diene |
| SMILES | FC(F)(F)CO/C=C/C1(C(F)(F)F)C=CC=C1 |
| InChI | InChI=1S/C10H8F6O/c11-9(12,13)7-17-6-5-8(10(14,15)16)3-1-2-4-8/h1-6H,7H2/b6-5+ |
| InChIKey | TWDHPAPUNTYRTK-AATRIKPKSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|