C10H15NO2S — CID 163703497
3,7-dimethyl-7-methylsulfonyl-2H-azocine (PubChem CID 163703497) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 3,7-dimethyl-7-methylsulfonyl-2H-azocine.
| Compound Name | 3,7-dimethyl-7-methylsulfonyl-2H-azocine |
|---|---|
| PubChem CID | 163703497 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 3,7-dimethyl-7-methylsulfonyl-2H-azocine |
| SMILES | CC1=CC=CC(C)(S(C)(=O)=O)/C=N\C1 |
| InChI | InChI=1S/C10H15NO2S/c1-9-5-4-6-10(2,8-11-7-9)14(3,12)13/h4-6,8H,7H2,1-3H3/b6-4?,9-5?,11-8- |
| InChIKey | KDBKFHXMXNDMQU-BDWJUAIHSA-N |
| XLogP | 1.38 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |