C8H13NO2S — CID 142030269
(2E)-N,3-dimethyl-2-methylsulfonylpenta-2,4-dien-1-imine (PubChem CID 142030269) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is (2E)-N,3-dimethyl-2-methylsulfonylpenta-2,4-dien-1-imine.
| Compound Name | (2E)-N,3-dimethyl-2-methylsulfonylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142030269 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | (2E)-N,3-dimethyl-2-methylsulfonylpenta-2,4-dien-1-imine |
| SMILES | C=C/C(C)=C(\C=N\C)S(C)(=O)=O |
| InChI | InChI=1S/C8H13NO2S/c1-5-7(2)8(6-9-3)12(4,10)11/h5-6H,1H2,2-4H3/b8-7+,9-6+ |
| InChIKey | WNIKSHMMNLJLBU-KHHFIZIMSA-N |
| XLogP | 1.19 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|