C10H17NO2S — CID 163323755
N-[(2E,4E)-hepta-2,4-dienyl]-2-methylsulfonylethanimine (PubChem CID 163323755) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is N-[(2E,4E)-hepta-2,4-dienyl]-2-methylsulfonylethanimine.
| Compound Name | N-[(2E,4E)-hepta-2,4-dienyl]-2-methylsulfonylethanimine |
|---|---|
| PubChem CID | 163323755 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | N-[(2E,4E)-hepta-2,4-dienyl]-2-methylsulfonylethanimine |
| SMILES | CC/C=C/C=C/C/N=C/CS(C)(=O)=O |
| InChI | InChI=1S/C10H17NO2S/c1-3-4-5-6-7-8-11-9-10-14(2,12)13/h4-7,9H,3,8,10H2,1-2H3/b5-4+,7-6+,11-9+ |
| InChIKey | WKWCPVBUXKFXTP-QJNQIVMESA-N |
| XLogP | 1.62 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|