C28H28N6O7S — CID 163703535
[(1S,3R,4S)-3-ethyl-4-[5-(4-methylcyclohexa-1,3-dien-1-yl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl] (4-nitrophenyl) carbonate (PubChem CID 163703535) has the molecular formula C28H28N6O7S and a molecular weight of 592.63 g/mol. Its IUPAC name is [(1S,3R,4S)-3-ethyl-4-[5-(4-methylcyclohexa-1,3-dien-1-yl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl] (4-nitrophenyl) carbonate.
| Compound Name | [(1S,3R,4S)-3-ethyl-4-[5-(4-methylcyclohexa-1,3-dien-1-yl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 163703535 |
| Molecular Formula | C28H28N6O7S |
| Molecular Weight | 592.63 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | [(1S,3R,4S)-3-ethyl-4-[5-(4-methylcyclohexa-1,3-dien-1-yl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl] (4-nitrophenyl) carbonate |
| SMILES | CC[C@@H]1C[C@H](OC(=O)Oc2ccc([N+](=O)[O-])cc2)C[C@@H]1c1nnc2cnc3c(ccn3S(=O)(=O)C3=CC=C(C)CC3)n12 |
| InChI | InChI=1S/C28H28N6O7S/c1-3-18-14-21(41-28(35)40-20-8-6-19(7-9-20)34(36)37)15-23(18)26-31-30-25-16-29-27-24(33(25)26)12-13-32(27)42(38,39)22-10-4-17(2)5-11-22/h4,6-10,12-13,16,18,21,23H,3,5,11,14-15H2,1-2H3/t18-,21+,23+/m1/s1 |
| InChIKey | KDCCNSWFBSMZGG-JZWVFAODSA-N |
| XLogP | 5.28 |
| TPSA | 160.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|