C12H15N2O3S+ — CID 163703829
(4R)-2-(2-hydroxyanilino)-5,5-dimethyl-4H-1,3-thiazol-3-ium-4-carboxylic acid (PubChem CID 163703829) has the molecular formula C12H15N2O3S+ and a molecular weight of 267.33 g/mol. Its IUPAC name is (4R)-2-(2-hydroxyanilino)-5,5-dimethyl-4H-1,3-thiazol-3-ium-4-carboxylic acid.
| Compound Name | (4R)-2-(2-hydroxyanilino)-5,5-dimethyl-4H-1,3-thiazol-3-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 163703829 |
| Molecular Formula | C12H15N2O3S+ |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | (4R)-2-(2-hydroxyanilino)-5,5-dimethyl-4H-1,3-thiazol-3-ium-4-carboxylic acid |
| SMILES | CC1(C)SC(Nc2ccccc2O)=[NH+][C@@H]1C(=O)O |
| InChI | InChI=1S/C12H14N2O3S/c1-12(2)9(10(16)17)14-11(18-12)13-7-5-3-4-6-8(7)15/h3-6,9,15H,1-2H3,(H,13,14)(H,16,17)/p+1/t9-/m1/s1 |
| InChIKey | OASISJWJIHWVKX-SECBINFHSA-O |
| XLogP | 0.22 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|