C22H36N4O — CID 163703903
4-[(2S,4S,6R)-4-methoxy-2-(3-methyl-2-pyridinyl)-6-(3-methyl-2,3,4,5-tetrahydropyridin-2-yl)piperidin-1-yl]butan-1-amine (PubChem CID 163703903) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is 4-[(2S,4S,6R)-4-methoxy-2-(3-methyl-2-pyridinyl)-6-(3-methyl-2,3,4,5-tetrahydropyridin-2-yl)piperidin-1-yl]butan-1-amine.
| Compound Name | 4-[(2S,4S,6R)-4-methoxy-2-(3-methyl-2-pyridinyl)-6-(3-methyl-2,3,4,5-tetrahydropyridin-2-yl)piperidin-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 163703903 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 4-[(2S,4S,6R)-4-methoxy-2-(3-methyl-2-pyridinyl)-6-(3-methyl-2,3,4,5-tetrahydropyridin-2-yl)piperidin-1-yl]butan-1-amine |
| SMILES | CO[C@H]1C[C@H](C2N=CCCC2C)N(CCCCN)[C@H](c2ncccc2C)C1 |
| InChI | InChI=1S/C22H36N4O/c1-16-8-6-11-24-21(16)19-14-18(27-3)15-20(26(19)13-5-4-10-23)22-17(2)9-7-12-25-22/h6,8,11-12,17-20,22H,4-5,7,9-10,13-15,23H2,1-3H3/t17?,18-,19+,20-,22?/m1/s1 |
| InChIKey | KDJVKWQHVUMFMS-ULGBUEHHSA-N |
| XLogP | 3.52 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|