C28H29N5O5 — CID 163705256
6-[3-[(4-methylphenyl)methyl]-2,6-dioxo-4-(4-pyridin-2-yloxyanilino)-1,3,5-triazin-1-yl]hexanoic acid (PubChem CID 163705256) has the molecular formula C28H29N5O5 and a molecular weight of 515.57 g/mol. Its IUPAC name is 6-[3-[(4-methylphenyl)methyl]-2,6-dioxo-4-(4-pyridin-2-yloxyanilino)-1,3,5-triazin-1-yl]hexanoic acid.
| Compound Name | 6-[3-[(4-methylphenyl)methyl]-2,6-dioxo-4-(4-pyridin-2-yloxyanilino)-1,3,5-triazin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 163705256 |
| Molecular Formula | C28H29N5O5 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 6-[3-[(4-methylphenyl)methyl]-2,6-dioxo-4-(4-pyridin-2-yloxyanilino)-1,3,5-triazin-1-yl]hexanoic acid |
| SMILES | Cc1ccc(Cn2c(Nc3ccc(Oc4ccccn4)cc3)nc(=O)n(CCCCCC(=O)O)c2=O)cc1 |
| InChI | InChI=1S/C28H29N5O5/c1-20-9-11-21(12-10-20)19-33-26(31-27(36)32(28(33)37)18-6-2-3-8-25(34)35)30-22-13-15-23(16-14-22)38-24-7-4-5-17-29-24/h4-5,7,9-17H,2-3,6,8,18-19H2,1H3,(H,34,35)(H,30,31,36) |
| InChIKey | KENAQIAHVYHQJO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|