C20H22N2OS — CID 163712427
1-(7-azaspiro[3.5]nonan-7-yl)-7-methylsulfanyl-3-oxo-4H-naphthalene-2-carbonitrile (PubChem CID 163712427) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is 1-(7-azaspiro[3.5]nonan-7-yl)-7-methylsulfanyl-3-oxo-4H-naphthalene-2-carbonitrile.
| Compound Name | 1-(7-azaspiro[3.5]nonan-7-yl)-7-methylsulfanyl-3-oxo-4H-naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 163712427 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-(7-azaspiro[3.5]nonan-7-yl)-7-methylsulfanyl-3-oxo-4H-naphthalene-2-carbonitrile |
| SMILES | CSc1ccc2c(c1)C(N1CCC3(CCC3)CC1)=C(C#N)C(=O)C2 |
| InChI | InChI=1S/C20H22N2OS/c1-24-15-4-3-14-11-18(23)17(13-21)19(16(14)12-15)22-9-7-20(8-10-22)5-2-6-20/h3-4,12H,2,5-11H2,1H3 |
| InChIKey | KKKRAWZTTXGLAD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |