C38H28N4O — CID 163715029
N-[(1Z,3E)-4-[3-(5a,9a-dihydrodibenzofuran-2-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]buta-1,3-dienyl]methanimine (PubChem CID 163715029) has the molecular formula C38H28N4O and a molecular weight of 556.67 g/mol. Its IUPAC name is N-[(1Z,3E)-4-[3-(5a,9a-dihydrodibenzofuran-2-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]buta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3E)-4-[3-(5a,9a-dihydrodibenzofuran-2-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]buta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 163715029 |
| Molecular Formula | C38H28N4O |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | N-[(1Z,3E)-4-[3-(5a,9a-dihydrodibenzofuran-2-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]buta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C\C=C\c1cc(-c2ccc3c(c2)C2C=CC=CC2O3)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C38H28N4O/c1-39-21-11-10-12-26-22-30(29-19-20-35-33(25-29)32-17-8-9-18-34(32)43-35)24-31(23-26)38-41-36(27-13-4-2-5-14-27)40-37(42-38)28-15-6-3-7-16-28/h2-25,32,34H,1H2/b12-10+,21-11- |
| InChIKey | KMPFVUAEBZVCIZ-ACQMRMIHSA-N |
| XLogP | 8.74 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|