C58H44BCl3N2O2 — CID 163716903
6-chloro-1-(10-methylfluoranthen-8-yl)isoquinoline;1,6-dichloroisoquinoline;4,4,5,5-tetramethyl-2-(10-methylfluoranthen-8-yl)-1,3,2-dioxaborolane (PubChem CID 163716903) has the molecular formula C58H44BCl3N2O2 and a molecular weight of 918.17 g/mol. Its IUPAC name is 6-chloro-1-(10-methylfluoranthen-8-yl)isoquinoline;1,6-dichloroisoquinoline;4,4,5,5-tetramethyl-2-(10-methylfluoranthen-8-yl)-1,3,2-dioxaborolane.
| Compound Name | 6-chloro-1-(10-methylfluoranthen-8-yl)isoquinoline;1,6-dichloroisoquinoline;4,4,5,5-tetramethyl-2-(10-methylfluoranthen-8-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 163716903 |
| Molecular Formula | C58H44BCl3N2O2 |
| Molecular Weight | 918.17 g/mol |
| Exact Mass | 916.26 |
| IUPAC Name | 6-chloro-1-(10-methylfluoranthen-8-yl)isoquinoline;1,6-dichloroisoquinoline;4,4,5,5-tetramethyl-2-(10-methylfluoranthen-8-yl)-1,3,2-dioxaborolane |
| SMILES | Cc1cc(-c2nccc3cc(Cl)ccc23)cc2c1-c1cccc3cccc-2c13.Cc1cc(B2OC(C)(C)C(C)(C)O2)cc2c1-c1cccc3cccc-2c13.Clc1ccc2c(Cl)nccc2c1 |
| InChI | InChI=1S/C26H16ClN.C23H23BO2.C9H5Cl2N/c1-15-12-18(26-20-9-8-19(27)13-17(20)10-11-28-26)14-23-21-6-2-4-16-5-3-7-22(24(15)23)25(16)21;1-14-12-16(24-25-22(2,3)23(4,5)26-24)13-19-17-10-6-8-15-9-7-11-18(20(14)19)21(15)17;10-7-1-2-8-6(5-7)3-4-12-9(8)11/h2-14H,1H3;6-13H,1-5H3;1-5H |
| InChIKey | KODSZVULKLCMGT-UHFFFAOYSA-N |
| XLogP | 16.30 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.17 |
| LogP ≤ 5 | 16.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|