C14H20FNO3S — CID 163718501
N-[(1R,2S)-3-fluoro-1-methoxy-1-[4-(2-methoxyethylsulfinyl)phenyl]propan-2-yl]methanimine (PubChem CID 163718501) has the molecular formula C14H20FNO3S and a molecular weight of 301.38 g/mol. Its IUPAC name is N-[(1R,2S)-3-fluoro-1-methoxy-1-[4-(2-methoxyethylsulfinyl)phenyl]propan-2-yl]methanimine.
| Compound Name | N-[(1R,2S)-3-fluoro-1-methoxy-1-[4-(2-methoxyethylsulfinyl)phenyl]propan-2-yl]methanimine |
|---|---|
| PubChem CID | 163718501 |
| Molecular Formula | C14H20FNO3S |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[(1R,2S)-3-fluoro-1-methoxy-1-[4-(2-methoxyethylsulfinyl)phenyl]propan-2-yl]methanimine |
| SMILES | C=N[C@H](CF)[C@H](OC)c1ccc(S(=O)CCOC)cc1 |
| InChI | InChI=1S/C14H20FNO3S/c1-16-13(10-15)14(19-3)11-4-6-12(7-5-11)20(17)9-8-18-2/h4-7,13-14H,1,8-10H2,2-3H3/t13-,14-,20?/m1/s1 |
| InChIKey | KPLAZNINYJJAFX-SYVYAKSWSA-N |
| XLogP | 2.17 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|