C9H14O6S — CID 163718859
methyl 4,7-dimethyl-2,2-dioxo-3,6-dioxa-2λ6-thiabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 163718859) has the molecular formula C9H14O6S and a molecular weight of 250.27 g/mol. Its IUPAC name is methyl 4,7-dimethyl-2,2-dioxo-3,6-dioxa-2λ6-thiabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | methyl 4,7-dimethyl-2,2-dioxo-3,6-dioxa-2λ6-thiabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 163718859 |
| Molecular Formula | C9H14O6S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | methyl 4,7-dimethyl-2,2-dioxo-3,6-dioxa-2λ6-thiabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | COC(=O)C12CC(OC1C)C(C)OS2(=O)=O |
| InChI | InChI=1S/C9H14O6S/c1-5-7-4-9(6(2)14-7,8(10)13-3)16(11,12)15-5/h5-7H,4H2,1-3H3 |
| InChIKey | KPSMANOKGDIZCS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|