C12H18O6S — CID 138520013
methyl 2,2-diethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carboxylate (PubChem CID 138520013) has the molecular formula C12H18O6S and a molecular weight of 290.34 g/mol. Its IUPAC name is methyl 2,2-diethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carboxylate.
| Compound Name | methyl 2,2-diethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carboxylate |
|---|---|
| PubChem CID | 138520013 |
| Molecular Formula | C12H18O6S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | methyl 2,2-diethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carboxylate |
| SMILES | CCC1(CC)C2CC3(C(=O)OC)C(O2)C1OS3(=O)=O |
| InChI | InChI=1S/C12H18O6S/c1-4-11(5-2)7-6-12(10(13)16-3)9(17-7)8(11)18-19(12,14)15/h7-9H,4-6H2,1-3H3 |
| InChIKey | VOQIODJLKCOGQH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|