C8H10O7S — CID 90266714
methyl 2-hydroxy-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carboxylate (PubChem CID 90266714) has the molecular formula C8H10O7S and a molecular weight of 250.23 g/mol. Its IUPAC name is methyl 2-hydroxy-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carboxylate.
| Compound Name | methyl 2-hydroxy-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carboxylate |
|---|---|
| PubChem CID | 90266714 |
| Molecular Formula | C8H10O7S |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | methyl 2-hydroxy-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-6-carboxylate |
| SMILES | COC(=O)C12CC3OC1C(OS2(=O)=O)C3O |
| InChI | InChI=1S/C8H10O7S/c1-13-7(10)8-2-3-4(9)5(6(8)14-3)15-16(8,11)12/h3-6,9H,2H2,1H3 |
| InChIKey | DHBCWGFBRIWNED-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|