C14H18O — CID 163719188
3-pent-4-enyl-3,4-dihydro-2H-chromene (PubChem CID 163719188) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-pent-4-enyl-3,4-dihydro-2H-chromene.
| Compound Name | 3-pent-4-enyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 163719188 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3-pent-4-enyl-3,4-dihydro-2H-chromene |
| SMILES | C=CCCCC1COc2ccccc2C1 |
| InChI | InChI=1S/C14H18O/c1-2-3-4-7-12-10-13-8-5-6-9-14(13)15-11-12/h2,5-6,8-9,12H,1,3-4,7,10-11H2 |
| InChIKey | KQALZEMDMNMLRB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|