C10H12O4S — CID 91592911
3,4-dihydro-2H-chromen-3-ylmethyl hydrogen sulfite (PubChem CID 91592911) has the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-3-ylmethyl hydrogen sulfite.
| Compound Name | 3,4-dihydro-2H-chromen-3-ylmethyl hydrogen sulfite |
|---|---|
| PubChem CID | 91592911 |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 3,4-dihydro-2H-chromen-3-ylmethyl hydrogen sulfite |
| SMILES | O=S(O)OCC1COc2ccccc2C1 |
| InChI | InChI=1S/C10H12O4S/c11-15(12)14-7-8-5-9-3-1-2-4-10(9)13-6-8/h1-4,8H,5-7H2,(H,11,12) |
| InChIKey | OKPVSJNKBPGSJD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|