C9H15NO2 — CID 163719227
1-[(4S)-4-(hydroxymethylamino)cyclohexa-1,5-dien-1-yl]ethanol (PubChem CID 163719227) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 1-[(4S)-4-(hydroxymethylamino)cyclohexa-1,5-dien-1-yl]ethanol.
| Compound Name | 1-[(4S)-4-(hydroxymethylamino)cyclohexa-1,5-dien-1-yl]ethanol |
|---|---|
| PubChem CID | 163719227 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 1-[(4S)-4-(hydroxymethylamino)cyclohexa-1,5-dien-1-yl]ethanol |
| SMILES | CC(O)C1=CC[C@H](NCO)C=C1 |
| InChI | InChI=1S/C9H15NO2/c1-7(12)8-2-4-9(5-3-8)10-6-11/h2-4,7,9-12H,5-6H2,1H3/t7?,9-/m1/s1 |
| InChIKey | KQBJUYUOBLBAHI-NHSZFOGYSA-N |
| XLogP | 0.16 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|