C14H22N4O — CID 163721507
(2S)-1-but-2-ynoyl-N,N'-dimethyl-N-[(Z)-2-(methylamino)ethenyl]pyrrolidine-2-carboximidamide (PubChem CID 163721507) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is (2S)-1-but-2-ynoyl-N,N'-dimethyl-N-[(Z)-2-(methylamino)ethenyl]pyrrolidine-2-carboximidamide.
| Compound Name | (2S)-1-but-2-ynoyl-N,N'-dimethyl-N-[(Z)-2-(methylamino)ethenyl]pyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 163721507 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (2S)-1-but-2-ynoyl-N,N'-dimethyl-N-[(Z)-2-(methylamino)ethenyl]pyrrolidine-2-carboximidamide |
| SMILES | CC#CC(=O)N1CCC[C@H]1/C(=N/C)N(C)/C=C\NC |
| InChI | InChI=1S/C14H22N4O/c1-5-7-13(19)18-10-6-8-12(18)14(16-3)17(4)11-9-15-2/h9,11-12,15H,6,8,10H2,1-4H3/b11-9-,16-14-/t12-/m0/s1 |
| InChIKey | KRZSIEFXXHHYFR-QKFPYTDLSA-N |
| XLogP | 0.65 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|