C13H20N2O4 — CID 163721839
N-[2-[2-[2-(methylamino)-2-oxoethoxy]ethoxy]ethyl]cyclopenta-1,4-diene-1-carboxamide (PubChem CID 163721839) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N-[2-[2-[2-(methylamino)-2-oxoethoxy]ethoxy]ethyl]cyclopenta-1,4-diene-1-carboxamide.
| Compound Name | N-[2-[2-[2-(methylamino)-2-oxoethoxy]ethoxy]ethyl]cyclopenta-1,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 163721839 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[2-[2-[2-(methylamino)-2-oxoethoxy]ethoxy]ethyl]cyclopenta-1,4-diene-1-carboxamide |
| SMILES | CNC(=O)COCCOCCNC(=O)C1=CCC=C1 |
| InChI | InChI=1S/C13H20N2O4/c1-14-12(16)10-19-9-8-18-7-6-15-13(17)11-4-2-3-5-11/h2,4-5H,3,6-10H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | KSFPHWQLIBVHQL-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|