C15H24N2O4 — CID 142170272
(2E)-2-[(Z)-but-2-enylidene]-N,N'-bis(2-methoxyethyl)-3-methylidenebutanediamide (PubChem CID 142170272) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is (2E)-2-[(Z)-but-2-enylidene]-N,N'-bis(2-methoxyethyl)-3-methylidenebutanediamide.
| Compound Name | (2E)-2-[(Z)-but-2-enylidene]-N,N'-bis(2-methoxyethyl)-3-methylidenebutanediamide |
|---|---|
| PubChem CID | 142170272 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (2E)-2-[(Z)-but-2-enylidene]-N,N'-bis(2-methoxyethyl)-3-methylidenebutanediamide |
| SMILES | C=C(C(=O)NCCOC)/C(=C\C=C/C)C(=O)NCCOC |
| InChI | InChI=1S/C15H24N2O4/c1-5-6-7-13(15(19)17-9-11-21-4)12(2)14(18)16-8-10-20-3/h5-7H,2,8-11H2,1,3-4H3,(H,16,18)(H,17,19)/b6-5-,13-7+ |
| InChIKey | GNZZGMBBKQMEMZ-RKOYKYSNSA-N |
| XLogP | 0.57 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|