C15H21N5O4 — CID 142170270
3-[[(2E,3E)-2-ethylidene-4-(2-methoxyethylcarbamoyl)hexa-3,5-dienoyl]amino]propanoyl azide (PubChem CID 142170270) has the molecular formula C15H21N5O4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 3-[[(2E,3E)-2-ethylidene-4-(2-methoxyethylcarbamoyl)hexa-3,5-dienoyl]amino]propanoyl azide.
| Compound Name | 3-[[(2E,3E)-2-ethylidene-4-(2-methoxyethylcarbamoyl)hexa-3,5-dienoyl]amino]propanoyl azide |
|---|---|
| PubChem CID | 142170270 |
| Molecular Formula | C15H21N5O4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 3-[[(2E,3E)-2-ethylidene-4-(2-methoxyethylcarbamoyl)hexa-3,5-dienoyl]amino]propanoyl azide |
| SMILES | C=C/C(=C\C(=C/C)C(=O)NCCC(=O)N=[N+]=[N-])C(=O)NCCOC |
| InChI | InChI=1S/C15H21N5O4/c1-4-11(14(22)17-7-6-13(21)19-20-16)10-12(5-2)15(23)18-8-9-24-3/h4-5,10H,2,6-9H2,1,3H3,(H,17,22)(H,18,23)/b11-4+,12-10+ |
| InChIKey | QMLPBUBRUBLAHE-ADAYYPRKSA-N |
| XLogP | 1.15 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|