C26H32N4O3S — CID 163722802
6-hydroxyhexyl 2-[4,5,13-trimethyl-7-(4-methylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate (PubChem CID 163722802) has the molecular formula C26H32N4O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is 6-hydroxyhexyl 2-[4,5,13-trimethyl-7-(4-methylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate.
| Compound Name | 6-hydroxyhexyl 2-[4,5,13-trimethyl-7-(4-methylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
|---|---|
| PubChem CID | 163722802 |
| Molecular Formula | C26H32N4O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 6-hydroxyhexyl 2-[4,5,13-trimethyl-7-(4-methylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| SMILES | Cc1ccc(C2=NC(CC(=O)OCCCCCCO)c3nnc(C)n3-c3sc(C)c(C)c32)cc1 |
| InChI | InChI=1S/C26H32N4O3S/c1-16-9-11-20(12-10-16)24-23-17(2)18(3)34-26(23)30-19(4)28-29-25(30)21(27-24)15-22(32)33-14-8-6-5-7-13-31/h9-12,21,31H,5-8,13-15H2,1-4H3 |
| InChIKey | KTAHCYIYSRUHMK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|